C18H23N2O3P — CID 125498774
1-butyl-3-[phenyl(phenylmethoxy)phosphoryl]urea (PubChem CID 125498774) has the molecular formula C18H23N2O3P and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-butyl-3-[phenyl(phenylmethoxy)phosphoryl]urea.
| Compound Name | 1-butyl-3-[phenyl(phenylmethoxy)phosphoryl]urea |
|---|---|
| PubChem CID | 125498774 |
| Molecular Formula | C18H23N2O3P |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-butyl-3-[phenyl(phenylmethoxy)phosphoryl]urea |
| SMILES | CCCCNC(=O)N[P@](=O)(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N2O3P/c1-2-3-14-19-18(21)20-24(22,17-12-8-5-9-13-17)23-15-16-10-6-4-7-11-16/h4-13H,2-3,14-15H2,1H3,(H2,19,20,21,22)/t24-/m1/s1 |
| InChIKey | AJIKXGINSSJDPO-XMMPIXPASA-N |
| XLogP | 3.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|