C11H7F3O — CID 11481265
1,1,1-trifluoro-4-(4-methylphenyl)but-3-yn-2-one (PubChem CID 11481265) has the molecular formula C11H7F3O and a molecular weight of 212.17 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(4-methylphenyl)but-3-yn-2-one.
| Compound Name | 1,1,1-trifluoro-4-(4-methylphenyl)but-3-yn-2-one |
|---|---|
| PubChem CID | 11481265 |
| Molecular Formula | C11H7F3O |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1,1,1-trifluoro-4-(4-methylphenyl)but-3-yn-2-one |
| SMILES | Cc1ccc(C#CC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F3O/c1-8-2-4-9(5-3-8)6-7-10(15)11(12,13)14/h2-5H,1H3 |
| InChIKey | MKJSEHNNBNNSAH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|