C22H18F3N — CID 102428527
1,1,1-trifluoro-N-(2-hex-1-ynylphenyl)-4-phenylbut-3-yn-2-imine (PubChem CID 102428527) has the molecular formula C22H18F3N and a molecular weight of 353.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(2-hex-1-ynylphenyl)-4-phenylbut-3-yn-2-imine.
| Compound Name | 1,1,1-trifluoro-N-(2-hex-1-ynylphenyl)-4-phenylbut-3-yn-2-imine |
|---|---|
| PubChem CID | 102428527 |
| Molecular Formula | C22H18F3N |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1,1,1-trifluoro-N-(2-hex-1-ynylphenyl)-4-phenylbut-3-yn-2-imine |
| SMILES | CCCCC#Cc1ccccc1/N=C(\C#Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H18F3N/c1-2-3-4-8-13-19-14-9-10-15-20(19)26-21(22(23,24)25)17-16-18-11-6-5-7-12-18/h5-7,9-12,14-15H,2-4H2,1H3/b26-21+ |
| InChIKey | KRJMAMCFBKCFDZ-YYADALCUSA-N |
| XLogP | 5.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|