C19H22 — CID 11807093
[(Z)-3-ethyl-4-methyldec-3-en-1,5-diynyl]benzene (PubChem CID 11807093) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is [(Z)-3-ethyl-4-methyldec-3-en-1,5-diynyl]benzene.
| Compound Name | [(Z)-3-ethyl-4-methyldec-3-en-1,5-diynyl]benzene |
|---|---|
| PubChem CID | 11807093 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [(Z)-3-ethyl-4-methyldec-3-en-1,5-diynyl]benzene |
| SMILES | CCCCC#C/C(C)=C(\C#Cc1ccccc1)CC |
| InChI | InChI=1S/C19H22/c1-4-6-7-9-12-17(3)19(5-2)16-15-18-13-10-8-11-14-18/h8,10-11,13-14H,4-7H2,1-3H3/b19-17- |
| InChIKey | IKZODIZTRIKQEZ-ZPHPHTNESA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|