C17H23NOS — CID 90183192
(NZ,S)-N-(4,4-dimethyl-1-phenylpent-1-yn-3-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 90183192) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is (NZ,S)-N-(4,4-dimethyl-1-phenylpent-1-yn-3-ylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,S)-N-(4,4-dimethyl-1-phenylpent-1-yn-3-ylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90183192 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (NZ,S)-N-(4,4-dimethyl-1-phenylpent-1-yn-3-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)/C(C#Cc1ccccc1)=N/[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C17H23NOS/c1-16(2,3)15(18-20(19)17(4,5)6)13-12-14-10-8-7-9-11-14/h7-11H,1-6H3/b18-15+/t20-/m0/s1 |
| InChIKey | IGDFGMJGWNAHLJ-POLXVDLBSA-N |
| XLogP | 3.99 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|