C17H20BrNO2S — CID 139091459
(NZ,R)-N-[(2-bromophenyl)-phenylmethylidene]-2-methylpropane-2-sulfinamide;hydrate (PubChem CID 139091459) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is (NZ,R)-N-[(2-bromophenyl)-phenylmethylidene]-2-methylpropane-2-sulfinamide;hydrate.
| Compound Name | (NZ,R)-N-[(2-bromophenyl)-phenylmethylidene]-2-methylpropane-2-sulfinamide;hydrate |
|---|---|
| PubChem CID | 139091459 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | (NZ,R)-N-[(2-bromophenyl)-phenylmethylidene]-2-methylpropane-2-sulfinamide;hydrate |
| SMILES | CC(C)(C)[S@@](=O)/N=C(/c1ccccc1)c1ccccc1Br.O |
| InChI | InChI=1S/C17H18BrNOS.H2O/c1-17(2,3)21(20)19-16(13-9-5-4-6-10-13)14-11-7-8-12-15(14)18;/h4-12H,1-3H3;1H2/b19-16-;/t21-;/m1./s1 |
| InChIKey | GILBVPGNWXECBY-NZDDJUGXSA-N |
| XLogP | 3.92 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|