C17H27NO2S — CID 135077221
(NE,R)-N-[(3S)-3-hydroxy-4,4-dimethyl-1-phenylpentylidene]-2-methylpropane-2-sulfinamide (PubChem CID 135077221) has the molecular formula C17H27NO2S and a molecular weight of 309.47 g/mol. Its IUPAC name is (NE,R)-N-[(3S)-3-hydroxy-4,4-dimethyl-1-phenylpentylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[(3S)-3-hydroxy-4,4-dimethyl-1-phenylpentylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135077221 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (NE,R)-N-[(3S)-3-hydroxy-4,4-dimethyl-1-phenylpentylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[C@@H](O)C/C(=N\[S@](=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H27NO2S/c1-16(2,3)15(19)12-14(13-10-8-7-9-11-13)18-21(20)17(4,5)6/h7-11,15,19H,12H2,1-6H3/b18-14+/t15-,21+/m0/s1 |
| InChIKey | BXLREDAINGIAQB-OMTVFEBXSA-N |
| XLogP | 3.73 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|