C23H32O6 — CID 66896604
benzoic acid;2,2-dimethylheptane-3,5-diol (PubChem CID 66896604) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is benzoic acid;2,2-dimethylheptane-3,5-diol.
| Compound Name | benzoic acid;2,2-dimethylheptane-3,5-diol |
|---|---|
| PubChem CID | 66896604 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | benzoic acid;2,2-dimethylheptane-3,5-diol |
| SMILES | CCC(O)CC(O)C(C)(C)C.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H20O2.2C7H6O2/c1-5-7(10)6-8(11)9(2,3)4;2*8-7(9)6-4-2-1-3-5-6/h7-8,10-11H,5-6H2,1-4H3;2*1-5H,(H,8,9) |
| InChIKey | SOAGYFUGXXMBMJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |