C18H24F3NO3S — CID 140925016
ethyl (3R,5Z)-5-[(S)-tert-butylsulfinyl]imino-5-phenyl-3-(trifluoromethyl)pentanoate (PubChem CID 140925016) has the molecular formula C18H24F3NO3S and a molecular weight of 391.46 g/mol. Its IUPAC name is ethyl (3R,5Z)-5-[(S)-tert-butylsulfinyl]imino-5-phenyl-3-(trifluoromethyl)pentanoate.
| Compound Name | ethyl (3R,5Z)-5-[(S)-tert-butylsulfinyl]imino-5-phenyl-3-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 140925016 |
| Molecular Formula | C18H24F3NO3S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl (3R,5Z)-5-[(S)-tert-butylsulfinyl]imino-5-phenyl-3-(trifluoromethyl)pentanoate |
| SMILES | CCOC(=O)C[C@@H](C/C(=N/[S@@](=O)C(C)(C)C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO3S/c1-5-25-16(23)12-14(18(19,20)21)11-15(13-9-7-6-8-10-13)22-26(24)17(2,3)4/h6-10,14H,5,11-12H2,1-4H3/b22-15-/t14-,26+/m1/s1 |
| InChIKey | VVPMYZVDWIKMKG-MVYJOPKVSA-N |
| XLogP | 4.46 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|