C17H19F3O5 — CID 168863829
diethyl 2-[(2S)-1,1,1-trifluoro-4-oxo-4-phenylbutan-2-yl]propanedioate (PubChem CID 168863829) has the molecular formula C17H19F3O5 and a molecular weight of 360.33 g/mol. Its IUPAC name is diethyl 2-[(2S)-1,1,1-trifluoro-4-oxo-4-phenylbutan-2-yl]propanedioate.
| Compound Name | diethyl 2-[(2S)-1,1,1-trifluoro-4-oxo-4-phenylbutan-2-yl]propanedioate |
|---|---|
| PubChem CID | 168863829 |
| Molecular Formula | C17H19F3O5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | diethyl 2-[(2S)-1,1,1-trifluoro-4-oxo-4-phenylbutan-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](CC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3O5/c1-3-24-15(22)14(16(23)25-4-2)12(17(18,19)20)10-13(21)11-8-6-5-7-9-11/h5-9,12,14H,3-4,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | YGULKKHOCVXNOM-LBPRGKRZSA-N |
| XLogP | 3.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|