C13H11ClF2O5 — CID 175430356
2-(1-chloro-1,1-difluoro-4-oxo-4-phenylbutan-2-yl)propanedioic acid (PubChem CID 175430356) has the molecular formula C13H11ClF2O5 and a molecular weight of 320.67 g/mol. Its IUPAC name is 2-(1-chloro-1,1-difluoro-4-oxo-4-phenylbutan-2-yl)propanedioic acid.
| Compound Name | 2-(1-chloro-1,1-difluoro-4-oxo-4-phenylbutan-2-yl)propanedioic acid |
|---|---|
| PubChem CID | 175430356 |
| Molecular Formula | C13H11ClF2O5 |
| Molecular Weight | 320.67 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-(1-chloro-1,1-difluoro-4-oxo-4-phenylbutan-2-yl)propanedioic acid |
| SMILES | O=C(CC(C(C(=O)O)C(=O)O)C(F)(F)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H11ClF2O5/c14-13(15,16)8(10(11(18)19)12(20)21)6-9(17)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,18,19)(H,20,21) |
| InChIKey | GYLLNURZJLXZBC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|