C12H10F3NO4 — CID 59018496
(2R)-4-oxo-4-phenyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 59018496) has the molecular formula C12H10F3NO4 and a molecular weight of 289.21 g/mol. Its IUPAC name is (2R)-4-oxo-4-phenyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid.
| Compound Name | (2R)-4-oxo-4-phenyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 59018496 |
| Molecular Formula | C12H10F3NO4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (2R)-4-oxo-4-phenyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
| SMILES | O=C(C[C@@H](NC(=O)C(F)(F)F)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H10F3NO4/c13-12(14,15)11(20)16-8(10(18)19)6-9(17)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,16,20)(H,18,19)/t8-/m1/s1 |
| InChIKey | RGFFVHICWSNKLG-MRVPVSSYSA-N |
| XLogP | 1.39 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |