C20H25F3N2O6 — CID 102269400
(2S)-2-[[(2S)-1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 102269400) has the molecular formula C20H25F3N2O6 and a molecular weight of 446.42 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 102269400 |
| Molecular Formula | C20H25F3N2O6 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (2S)-2-[[(2S)-1-ethoxy-1,4-dioxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | CCOC(=O)[C@H](CC(=O)c1ccccc1)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H25F3N2O6/c1-2-31-18(29)15(12-16(26)13-8-4-3-5-9-13)25-14(17(27)28)10-6-7-11-24-19(30)20(21,22)23/h3-5,8-9,14-15,25H,2,6-7,10-12H2,1H3,(H,24,30)(H,27,28)/t14-,15-/m0/s1 |
| InChIKey | FVWHHBUWCTYFMG-GJZGRUSLSA-N |
| XLogP | 2.08 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|