C19H25F3N2O5 — CID 141479934
(2S)-2-[[(2S)-1-methoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 141479934) has the molecular formula C19H25F3N2O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-methoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-methoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 141479934 |
| Molecular Formula | C19H25F3N2O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (2S)-2-[[(2S)-1-methoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | COC(=O)[C@H](CCc1ccccc1)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C19H25F3N2O5/c1-29-17(27)15(11-10-13-7-3-2-4-8-13)24-14(16(25)26)9-5-6-12-23-18(28)19(20,21)22/h2-4,7-8,14-15,24H,5-6,9-12H2,1H3,(H,23,28)(H,25,26)/t14-,15-/m0/s1 |
| InChIKey | WCHYRRQSRFNDMB-GJZGRUSLSA-N |
| XLogP | 2.05 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|