C21H29F3N2O5 — CID 139503102
(2S)-2-[(1-oxo-4-phenyl-1-propan-2-yloxybutan-2-yl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 139503102) has the molecular formula C21H29F3N2O5 and a molecular weight of 446.47 g/mol. Its IUPAC name is (2S)-2-[(1-oxo-4-phenyl-1-propan-2-yloxybutan-2-yl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(1-oxo-4-phenyl-1-propan-2-yloxybutan-2-yl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 139503102 |
| Molecular Formula | C21H29F3N2O5 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2S)-2-[(1-oxo-4-phenyl-1-propan-2-yloxybutan-2-yl)amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | CC(C)OC(=O)C(CCc1ccccc1)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C21H29F3N2O5/c1-14(2)31-19(29)17(12-11-15-8-4-3-5-9-15)26-16(18(27)28)10-6-7-13-25-20(30)21(22,23)24/h3-5,8-9,14,16-17,26H,6-7,10-13H2,1-2H3,(H,25,30)(H,27,28)/t16-,17?/m0/s1 |
| InChIKey | LQMTZZFBPQZLAV-BHWOMJMDSA-N |
| XLogP | 2.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|