C18H24F3N5O4 — CID 86746038
(2S)-2-[[(2S)-1-amino-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;molecular nitrogen (PubChem CID 86746038) has the molecular formula C18H24F3N5O4 and a molecular weight of 431.42 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-amino-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;molecular nitrogen.
| Compound Name | (2S)-2-[[(2S)-1-amino-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;molecular nitrogen |
|---|---|
| PubChem CID | 86746038 |
| Molecular Formula | C18H24F3N5O4 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2S)-2-[[(2S)-1-amino-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;molecular nitrogen |
| SMILES | N#N.NC(=O)[C@H](CCc1ccccc1)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C18H24F3N3O4.N2/c19-18(20,21)17(28)23-11-5-4-8-14(16(26)27)24-13(15(22)25)10-9-12-6-2-1-3-7-12;1-2/h1-3,6-7,13-14,24H,4-5,8-11H2,(H2,22,25)(H,23,28)(H,26,27);/t13-,14-;/m0./s1 |
| InChIKey | IGQHTRHWMNUTBX-IODNYQNNSA-N |
| XLogP | 1.39 |
| TPSA | 169.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|