C6H7F3N2O5 — CID 23227676
4-(hydroxyamino)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 23227676) has the molecular formula C6H7F3N2O5 and a molecular weight of 244.12 g/mol. Its IUPAC name is 4-(hydroxyamino)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid.
| Compound Name | 4-(hydroxyamino)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 23227676 |
| Molecular Formula | C6H7F3N2O5 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 4-(hydroxyamino)-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
| SMILES | O=C(CC(NC(=O)C(F)(F)F)C(=O)O)NO |
| InChI | InChI=1S/C6H7F3N2O5/c7-6(8,9)5(15)10-2(4(13)14)1-3(12)11-16/h2,16H,1H2,(H,10,15)(H,11,12)(H,13,14) |
| InChIKey | PNQXEYMMUGRXIY-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|