C12H17F3N2O6 — CID 88966323
2-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]butanedioic acid (PubChem CID 88966323) has the molecular formula C12H17F3N2O6 and a molecular weight of 342.27 g/mol. Its IUPAC name is 2-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]butanedioic acid.
| Compound Name | 2-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 88966323 |
| Molecular Formula | C12H17F3N2O6 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)CCCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H17F3N2O6/c13-12(14,15)11(23)16-5-3-1-2-4-8(18)17-7(10(21)22)6-9(19)20/h7H,1-6H2,(H,16,23)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | DXYMKGOWWDHHLL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|