C17H31NO6 — CID 171159696
2-[(11-hydroxy-10-methyldodecanoyl)amino]butanedioic acid (PubChem CID 171159696) has the molecular formula C17H31NO6 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[(11-hydroxy-10-methyldodecanoyl)amino]butanedioic acid.
| Compound Name | 2-[(11-hydroxy-10-methyldodecanoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 171159696 |
| Molecular Formula | C17H31NO6 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-[(11-hydroxy-10-methyldodecanoyl)amino]butanedioic acid |
| SMILES | CC(O)C(C)CCCCCCCCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H31NO6/c1-12(13(2)19)9-7-5-3-4-6-8-10-15(20)18-14(17(23)24)11-16(21)22/h12-14,19H,3-11H2,1-2H3,(H,18,20)(H,21,22)(H,23,24) |
| InChIKey | ABNMQHAFTTUSEY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|