C13H22N2O6 — CID 63307113
(2S)-2-(6-acetamidohexanoylamino)-4-methoxy-4-oxobutanoic acid (PubChem CID 63307113) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-2-(6-acetamidohexanoylamino)-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-(6-acetamidohexanoylamino)-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307113 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2S)-2-(6-acetamidohexanoylamino)-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)CCCCCNC(C)=O)C(=O)O |
| InChI | InChI=1S/C13H22N2O6/c1-9(16)14-7-5-3-4-6-11(17)15-10(13(19)20)8-12(18)21-2/h10H,3-8H2,1-2H3,(H,14,16)(H,15,17)(H,19,20)/t10-/m0/s1 |
| InChIKey | UKSNQYHWHQCASH-JTQLQIEISA-N |
| XLogP | -0.18 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|