C25H45N3O6 — CID 90132286
dimethyl 2-[[(Z)-13-(pentylcarbamoylamino)tridec-8-enoyl]amino]butanedioate (PubChem CID 90132286) has the molecular formula C25H45N3O6 and a molecular weight of 483.65 g/mol. Its IUPAC name is dimethyl 2-[[(Z)-13-(pentylcarbamoylamino)tridec-8-enoyl]amino]butanedioate.
| Compound Name | dimethyl 2-[[(Z)-13-(pentylcarbamoylamino)tridec-8-enoyl]amino]butanedioate |
|---|---|
| PubChem CID | 90132286 |
| Molecular Formula | C25H45N3O6 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | dimethyl 2-[[(Z)-13-(pentylcarbamoylamino)tridec-8-enoyl]amino]butanedioate |
| SMILES | CCCCCNC(=O)NCCCC/C=C\CCCCCCC(=O)NC(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C25H45N3O6/c1-4-5-15-18-26-25(32)27-19-16-13-11-9-7-6-8-10-12-14-17-22(29)28-21(24(31)34-3)20-23(30)33-2/h7,9,21H,4-6,8,10-20H2,1-3H3,(H,28,29)(H2,26,27,32)/b9-7- |
| InChIKey | BOYHPNFPSDRCEU-CLFYSBASSA-N |
| XLogP | 3.76 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|