C24H45N3O6 — CID 123268141
dimethyl 2-[[13-(butylcarbamoylamino)-1-hydroxytridec-8-enyl]amino]butanedioate (PubChem CID 123268141) has the molecular formula C24H45N3O6 and a molecular weight of 471.64 g/mol. Its IUPAC name is dimethyl 2-[[13-(butylcarbamoylamino)-1-hydroxytridec-8-enyl]amino]butanedioate.
| Compound Name | dimethyl 2-[[13-(butylcarbamoylamino)-1-hydroxytridec-8-enyl]amino]butanedioate |
|---|---|
| PubChem CID | 123268141 |
| Molecular Formula | C24H45N3O6 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | dimethyl 2-[[13-(butylcarbamoylamino)-1-hydroxytridec-8-enyl]amino]butanedioate |
| SMILES | CCCCNC(=O)NCCCCC=CCCCCCCC(O)NC(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H45N3O6/c1-4-5-17-25-24(31)26-18-15-13-11-9-7-6-8-10-12-14-16-21(28)27-20(23(30)33-3)19-22(29)32-2/h7,9,20-21,27-28H,4-6,8,10-19H2,1-3H3,(H2,25,26,31) |
| InChIKey | GHESNBHCWQONTF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|