C19H20O4 — CID 57327357
(3R,5S)-3,5-dihydroxy-1,7-diphenylheptane-1,7-dione (PubChem CID 57327357) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3R,5S)-3,5-dihydroxy-1,7-diphenylheptane-1,7-dione.
| Compound Name | (3R,5S)-3,5-dihydroxy-1,7-diphenylheptane-1,7-dione |
|---|---|
| PubChem CID | 57327357 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (3R,5S)-3,5-dihydroxy-1,7-diphenylheptane-1,7-dione |
| SMILES | O=C(C[C@@H](O)C[C@@H](O)CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O4/c20-16(12-18(22)14-7-3-1-4-8-14)11-17(21)13-19(23)15-9-5-2-6-10-15/h1-10,16-17,20-21H,11-13H2/t16-,17+ |
| InChIKey | NYLHTVSYTZMURW-CALCHBBNSA-N |
| XLogP | 2.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |