About dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate
dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate (PubChem CID 158712689) has the molecular formula C14H13K2NO6
and a molecular weight of 369.46 g/mol. Its IUPAC name is dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate.
Molecular Properties
| Compound Name | dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate |
| PubChem CID | 158712689 |
| Molecular Formula | C14H13K2NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate |
| SMILES | CCOC(=O)C(C#N)CC(=O)c1ccccc1.O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C13H13NO3.CH2O3.2K/c1-2-17-13(16)11(9-14)8-12(15)10-6-4-3-5-7-10;2-1(3)4;;/h3-7,11H,2,8H2,1H3;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | SCNCUMIUAFGELH-UHFFFAOYSA-L |
| XLogP | -6.48 |
| TPSA | 130.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | -6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate?
The IUPAC name of dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate (CID 158712689) is dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate.
What is the SMILES notation for dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate?
The canonical SMILES for dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate is CCOC(=O)C(C#N)CC(=O)c1ccccc1.O=C([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate?
The InChIKey is SCNCUMIUAFGELH-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H13NO3.CH2O3.2K/c1-2-17-13(16)11(9-14)8-12(15)10-6-4-3-5-7-10;2-1(3)4;;/h3-7,11H,2,8H2,1H3;(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate?
dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate has a molecular weight of 369.46 g/mol, XLogP of -6.48, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;ethyl 2-cyano-4-oxo-4-phenylbutanoate;carbonate is sourced from PubChem (CID 158712689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).