About 2-phenacylhexanenitrile
2-phenacylhexanenitrile (PubChem CID 162717827) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-phenacylhexanenitrile.
Molecular Properties
| Compound Name | 2-phenacylhexanenitrile |
| PubChem CID | 162717827 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-phenacylhexanenitrile |
| SMILES | CCCCC(C#N)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO/c1-2-3-7-12(11-15)10-14(16)13-8-5-4-6-9-13/h4-6,8-9,12H,2-3,7,10H2,1H3 |
| InChIKey | OBTDUASJQFESEP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenacylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenacylhexanenitrile?
The IUPAC name of 2-phenacylhexanenitrile (CID 162717827) is 2-phenacylhexanenitrile.
What is the SMILES notation for 2-phenacylhexanenitrile?
The canonical SMILES for 2-phenacylhexanenitrile is CCCCC(C#N)CC(=O)c1ccccc1.
What is the InChIKey of 2-phenacylhexanenitrile?
The InChIKey is OBTDUASJQFESEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-2-3-7-12(11-15)10-14(16)13-8-5-4-6-9-13/h4-6,8-9,12H,2-3,7,10H2,1H3.
What are the key properties of 2-phenacylhexanenitrile?
2-phenacylhexanenitrile has a molecular weight of 215.30 g/mol, XLogP of 3.59, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenacylhexanenitrile is sourced from PubChem (CID 162717827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).