About 2-cyanopentyl benzoate
2-cyanopentyl benzoate (PubChem CID 123568699) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-cyanopentyl benzoate.
Molecular Properties
| Compound Name | 2-cyanopentyl benzoate |
| PubChem CID | 123568699 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-cyanopentyl benzoate |
| SMILES | CCCC(C#N)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-2-6-11(9-14)10-16-13(15)12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,10H2,1H3 |
| InChIKey | LPKHNQCUZRUTFJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyanopentyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanopentyl benzoate?
The IUPAC name of 2-cyanopentyl benzoate (CID 123568699) is 2-cyanopentyl benzoate.
What is the SMILES notation for 2-cyanopentyl benzoate?
The canonical SMILES for 2-cyanopentyl benzoate is CCCC(C#N)COC(=O)c1ccccc1.
What is the InChIKey of 2-cyanopentyl benzoate?
The InChIKey is LPKHNQCUZRUTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-2-6-11(9-14)10-16-13(15)12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,10H2,1H3.
What are the key properties of 2-cyanopentyl benzoate?
2-cyanopentyl benzoate has a molecular weight of 217.27 g/mol, XLogP of 2.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanopentyl benzoate is sourced from PubChem (CID 123568699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).