ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate

C21H18ClNO4 — CID 44614627

IUPACethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate
SMILESCCOC(=O)C(C#N)C(CC(=O)c1ccccc1)C(=O)c1ccc(Cl)cc1
InChIInChI=1S/C21H18ClNO4/c1-2-27-21(26)18(13-23)17(12-19(24)14-6-4-3-5-7-14)20(25)15-8-10-16(22)11-9-15/h3-11,17-18H,2,12H2,1H3
InChIKeyDLPCJMLEIRAJHD-UHFFFAOYSA-N
MW383.83 g/mol
LogP4.11
Rot. Bonds8

About ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate

ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate (PubChem CID 44614627) has the molecular formula C21H18ClNO4 and a molecular weight of 383.83 g/mol. Its IUPAC name is ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate.

Molecular Properties

Compound Nameethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate
PubChem CID44614627
Molecular FormulaC21H18ClNO4
Molecular Weight383.83 g/mol
Exact Mass383.09
IUPAC Nameethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate
SMILESCCOC(=O)C(C#N)C(CC(=O)c1ccccc1)C(=O)c1ccc(Cl)cc1
InChIInChI=1S/C21H18ClNO4/c1-2-27-21(26)18(13-23)17(12-19(24)14-6-4-3-5-7-14)20(25)15-8-10-16(22)11-9-15/h3-11,17-18H,2,12H2,1H3
InChIKeyDLPCJMLEIRAJHD-UHFFFAOYSA-N
XLogP4.11
TPSA84.23 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500383.83
LogP ≤ 54.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate?
The IUPAC name of ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate (CID 44614627) is ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate.
What is the SMILES notation for ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate?
The canonical SMILES for ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate is CCOC(=O)C(C#N)C(CC(=O)c1ccccc1)C(=O)c1ccc(Cl)cc1.
What is the InChIKey of ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate?
The InChIKey is DLPCJMLEIRAJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClNO4/c1-2-27-21(26)18(13-23)17(12-19(24)14-6-4-3-5-7-14)20(25)15-8-10-16(22)11-9-15/h3-11,17-18H,2,12H2,1H3.
What are the key properties of ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate?
ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate has a molecular weight of 383.83 g/mol, XLogP of 4.11, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-chlorobenzoyl)-2-cyano-5-oxo-5-phenylpentanoate is sourced from PubChem (CID 44614627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).