C18H23FN2O3S — CID 163478193
ethyl 5-[(S)-tert-butylsulfinyl]imino-2-cyano-5-(4-fluorophenyl)pentanoate (PubChem CID 163478193) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is ethyl 5-[(S)-tert-butylsulfinyl]imino-2-cyano-5-(4-fluorophenyl)pentanoate.
| Compound Name | ethyl 5-[(S)-tert-butylsulfinyl]imino-2-cyano-5-(4-fluorophenyl)pentanoate |
|---|---|
| PubChem CID | 163478193 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 5-[(S)-tert-butylsulfinyl]imino-2-cyano-5-(4-fluorophenyl)pentanoate |
| SMILES | CCOC(=O)C(C#N)CCC(=N[S@@](=O)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN2O3S/c1-5-24-17(22)14(12-20)8-11-16(21-25(23)18(2,3)4)13-6-9-15(19)10-7-13/h6-7,9-10,14H,5,8,11H2,1-4H3/t14?,25-/m0/s1 |
| InChIKey | CCGFZZIBTLSSLO-CCKNNCGLSA-N |
| XLogP | 3.56 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|