C14H15FN2O2 — CID 129168904
ethyl 2-cyano-5-(4-fluorophenyl)-5-iminopentanoate (PubChem CID 129168904) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is ethyl 2-cyano-5-(4-fluorophenyl)-5-iminopentanoate.
| Compound Name | ethyl 2-cyano-5-(4-fluorophenyl)-5-iminopentanoate |
|---|---|
| PubChem CID | 129168904 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | ethyl 2-cyano-5-(4-fluorophenyl)-5-iminopentanoate |
| SMILES | [H]/N=C(\CCC(C#N)C(=O)OCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O2/c1-2-19-14(18)11(9-16)5-8-13(17)10-3-6-12(15)7-4-10/h3-4,6-7,11,17H,2,5,8H2,1H3/b17-13+ |
| InChIKey | NQVNNXNFCBGHRV-GHRIWEEISA-N |
| XLogP | 2.68 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|