C18H27FN2O3S — CID 134942547
tert-butyl N-[(1E,2S)-1-[(R)-tert-butylsulfinyl]imino-1-(4-fluorophenyl)propan-2-yl]carbamate (PubChem CID 134942547) has the molecular formula C18H27FN2O3S and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl N-[(1E,2S)-1-[(R)-tert-butylsulfinyl]imino-1-(4-fluorophenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1E,2S)-1-[(R)-tert-butylsulfinyl]imino-1-(4-fluorophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 134942547 |
| Molecular Formula | C18H27FN2O3S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl N-[(1E,2S)-1-[(R)-tert-butylsulfinyl]imino-1-(4-fluorophenyl)propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)/C(=N/[S@](=O)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H27FN2O3S/c1-12(20-16(22)24-17(2,3)4)15(21-25(23)18(5,6)7)13-8-10-14(19)11-9-13/h8-12H,1-7H3,(H,20,22)/b21-15-/t12-,25+/m0/s1 |
| InChIKey | VMKALMQAMDLOBI-BSILBASLSA-N |
| XLogP | 3.99 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|