C16H15N — CID 12676193
N,1-diphenylbut-3-en-1-imine (PubChem CID 12676193) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is N,1-diphenylbut-3-en-1-imine.
| Compound Name | N,1-diphenylbut-3-en-1-imine |
|---|---|
| PubChem CID | 12676193 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N,1-diphenylbut-3-en-1-imine |
| SMILES | C=CC/C(=N\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N/c1-2-9-16(14-10-5-3-6-11-14)17-15-12-7-4-8-13-15/h2-8,10-13H,1,9H2/b17-16+ |
| InChIKey | DUYJBQMXXGHUDA-WUKNDPDISA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|