C19H15ClN2S — CID 134917443
(2-chlorophenyl) N,N'-diphenylcarbamimidothioate (PubChem CID 134917443) has the molecular formula C19H15ClN2S and a molecular weight of 338.86 g/mol. Its IUPAC name is (2-chlorophenyl) N,N'-diphenylcarbamimidothioate.
| Compound Name | (2-chlorophenyl) N,N'-diphenylcarbamimidothioate |
|---|---|
| PubChem CID | 134917443 |
| Molecular Formula | C19H15ClN2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (2-chlorophenyl) N,N'-diphenylcarbamimidothioate |
| SMILES | Clc1ccccc1S/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C19H15ClN2S/c20-17-13-7-8-14-18(17)23-19(21-15-9-3-1-4-10-15)22-16-11-5-2-6-12-16/h1-14H,(H,21,22) |
| InChIKey | FFIZCWFCLVYDSK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|