C13H12Cl2N4 — CID 116515439
1-amino-2-(2,6-dichlorophenyl)-3-phenylguanidine (PubChem CID 116515439) has the molecular formula C13H12Cl2N4 and a molecular weight of 295.17 g/mol. Its IUPAC name is 1-amino-2-(2,6-dichlorophenyl)-3-phenylguanidine.
| Compound Name | 1-amino-2-(2,6-dichlorophenyl)-3-phenylguanidine |
|---|---|
| PubChem CID | 116515439 |
| Molecular Formula | C13H12Cl2N4 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-amino-2-(2,6-dichlorophenyl)-3-phenylguanidine |
| SMILES | NN/C(=N\c1c(Cl)cccc1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C13H12Cl2N4/c14-10-7-4-8-11(15)12(10)18-13(19-16)17-9-5-2-1-3-6-9/h1-8H,16H2,(H2,17,18,19) |
| InChIKey | DSOZMJIGUXWXKX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|