C17H16Cl2N2 — CID 144792170
N-[(Z)-4-(2,6-dichlorophenyl)iminopent-2-en-2-yl]aniline (PubChem CID 144792170) has the molecular formula C17H16Cl2N2 and a molecular weight of 319.24 g/mol. Its IUPAC name is N-[(Z)-4-(2,6-dichlorophenyl)iminopent-2-en-2-yl]aniline.
| Compound Name | N-[(Z)-4-(2,6-dichlorophenyl)iminopent-2-en-2-yl]aniline |
|---|---|
| PubChem CID | 144792170 |
| Molecular Formula | C17H16Cl2N2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[(Z)-4-(2,6-dichlorophenyl)iminopent-2-en-2-yl]aniline |
| SMILES | C/C(=C/C(C)=N/c1c(Cl)cccc1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C17H16Cl2N2/c1-12(20-14-7-4-3-5-8-14)11-13(2)21-17-15(18)9-6-10-16(17)19/h3-11,20H,1-2H3/b12-11-,21-13+ |
| InChIKey | XMHUOHFZNZGPMU-UNRWDFRVSA-N |
| XLogP | 6.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|