C38H72N2Si6 — CID 177423131
N-[(E)-4-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]iminopent-2-en-2-yl]aniline (PubChem CID 177423131) has the molecular formula C38H72N2Si6 and a molecular weight of 725.52 g/mol. Its IUPAC name is N-[(E)-4-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]iminopent-2-en-2-yl]aniline.
| Compound Name | N-[(E)-4-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]iminopent-2-en-2-yl]aniline |
|---|---|
| PubChem CID | 177423131 |
| Molecular Formula | C38H72N2Si6 |
| Molecular Weight | 725.52 g/mol |
| Exact Mass | 724.43 |
| IUPAC Name | N-[(E)-4-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]iminopent-2-en-2-yl]aniline |
| SMILES | C/C(=C\C(C)=N\c1c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc1C([Si](C)(C)C)[Si](C)(C)C)Nc1ccccc1 |
| InChI | InChI=1S/C38H72N2Si6/c1-29(39-32-24-22-21-23-25-32)26-30(2)40-35-33(37(43(9,10)11)44(12,13)14)27-31(36(41(3,4)5)42(6,7)8)28-34(35)38(45(15,16)17)46(18,19)20/h21-28,36-39H,1-20H3/b29-26+,40-30+ |
| InChIKey | OAFHSIHCGJTLBR-IKGDUFPUSA-N |
| XLogP | 13.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.52 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|