C29H42N2 — CID 101126796
2-propan-2-yl-N-[(Z)-4-(2-propan-2-yl-6-propylphenyl)iminopent-2-en-2-yl]-6-propylaniline (PubChem CID 101126796) has the molecular formula C29H42N2 and a molecular weight of 418.67 g/mol. Its IUPAC name is 2-propan-2-yl-N-[(Z)-4-(2-propan-2-yl-6-propylphenyl)iminopent-2-en-2-yl]-6-propylaniline.
| Compound Name | 2-propan-2-yl-N-[(Z)-4-(2-propan-2-yl-6-propylphenyl)iminopent-2-en-2-yl]-6-propylaniline |
|---|---|
| PubChem CID | 101126796 |
| Molecular Formula | C29H42N2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 2-propan-2-yl-N-[(Z)-4-(2-propan-2-yl-6-propylphenyl)iminopent-2-en-2-yl]-6-propylaniline |
| SMILES | CCCc1cccc(C(C)C)c1/N=C(C)/C=C(/C)Nc1c(CCC)cccc1C(C)C |
| InChI | InChI=1S/C29H42N2/c1-9-13-24-15-11-17-26(20(3)4)28(24)30-22(7)19-23(8)31-29-25(14-10-2)16-12-18-27(29)21(5)6/h11-12,15-21,30H,9-10,13-14H2,1-8H3/b22-19-,31-23+ |
| InChIKey | WISFOTPALNREAB-MWXKIHILSA-N |
| XLogP | 8.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|