C31H46N2O — CID 139158905
2,4-ditert-butyl-6-[[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]amino]phenol (PubChem CID 139158905) has the molecular formula C31H46N2O and a molecular weight of 462.72 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]amino]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]amino]phenol |
|---|---|
| PubChem CID | 139158905 |
| Molecular Formula | C31H46N2O |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]amino]phenol |
| SMILES | C/C(=C\C(C)=N\c1c(C(C)C)cccc1C(C)C)Nc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H46N2O/c1-19(2)24-14-13-15-25(20(3)4)28(24)33-22(6)16-21(5)32-27-18-23(30(7,8)9)17-26(29(27)34)31(10,11)12/h13-20,32,34H,1-12H3/b21-16+,33-22+ |
| InChIKey | YMMYMCHFSRNPPI-SXPNRKCGSA-N |
| XLogP | 9.34 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|