C21H26BrNO2 — CID 56698589
4-bromo-N-(3,5-ditert-butyl-2-hydroxyphenyl)benzamide (PubChem CID 56698589) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is 4-bromo-N-(3,5-ditert-butyl-2-hydroxyphenyl)benzamide.
| Compound Name | 4-bromo-N-(3,5-ditert-butyl-2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 56698589 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-bromo-N-(3,5-ditert-butyl-2-hydroxyphenyl)benzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccc(Br)cc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26BrNO2/c1-20(2,3)14-11-16(21(4,5)6)18(24)17(12-14)23-19(25)13-7-9-15(22)10-8-13/h7-12,24H,1-6H3,(H,23,25) |
| InChIKey | YPPYVYUVNDHENG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|