C23H28ClNO4 — CID 86274849
methyl 3-chloro-4-[(3,5-ditert-butyl-2-hydroxybenzoyl)amino]benzoate (PubChem CID 86274849) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is methyl 3-chloro-4-[(3,5-ditert-butyl-2-hydroxybenzoyl)amino]benzoate.
| Compound Name | methyl 3-chloro-4-[(3,5-ditert-butyl-2-hydroxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 86274849 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | methyl 3-chloro-4-[(3,5-ditert-butyl-2-hydroxybenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(Cl)c1 |
| InChI | InChI=1S/C23H28ClNO4/c1-22(2,3)14-11-15(19(26)16(12-14)23(4,5)6)20(27)25-18-9-8-13(10-17(18)24)21(28)29-7/h8-12,26H,1-7H3,(H,25,27) |
| InChIKey | NSTSNEYKBYZICN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |