C40H40ClNO2 — CID 175256591
3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxybenzamide (PubChem CID 175256591) has the molecular formula C40H40ClNO2 and a molecular weight of 602.22 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxybenzamide.
| Compound Name | 3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 175256591 |
| Molecular Formula | C40H40ClNO2 |
| Molecular Weight | 602.22 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxybenzamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2Cl)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H40ClNO2/c1-38(2,3)31-24-32(36(43)33(25-31)39(4,5)6)37(44)42-35-23-22-30(26-34(35)41)40(27-16-10-7-11-17-27,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-26,43H,1-6H3,(H,42,44) |
| InChIKey | QOZYWFIDSKSHER-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.22 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|