C19H21Cl2NO2 — CID 118641906
3-tert-butyl-5-chloro-N-(2-chloro-4-methylphenyl)-2-hydroxy-6-methylbenzamide (PubChem CID 118641906) has the molecular formula C19H21Cl2NO2 and a molecular weight of 366.29 g/mol. Its IUPAC name is 3-tert-butyl-5-chloro-N-(2-chloro-4-methylphenyl)-2-hydroxy-6-methylbenzamide.
| Compound Name | 3-tert-butyl-5-chloro-N-(2-chloro-4-methylphenyl)-2-hydroxy-6-methylbenzamide |
|---|---|
| PubChem CID | 118641906 |
| Molecular Formula | C19H21Cl2NO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-tert-butyl-5-chloro-N-(2-chloro-4-methylphenyl)-2-hydroxy-6-methylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2c(C)c(Cl)cc(C(C)(C)C)c2O)c(Cl)c1 |
| InChI | InChI=1S/C19H21Cl2NO2/c1-10-6-7-15(14(21)8-10)22-18(24)16-11(2)13(20)9-12(17(16)23)19(3,4)5/h6-9,23H,1-5H3,(H,22,24) |
| InChIKey | ZPXYYRRVFWQBQK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |