C19H18ClF3NO6S2- — CID 59191196
5-tert-butyl-3-[[2-chloro-4-(trifluoromethylsulfonyl)phenyl]carbamoyl]-4-hydroxy-2-methylbenzenesulfinate (PubChem CID 59191196) has the molecular formula C19H18ClF3NO6S2- and a molecular weight of 512.94 g/mol. Its IUPAC name is 5-tert-butyl-3-[[2-chloro-4-(trifluoromethylsulfonyl)phenyl]carbamoyl]-4-hydroxy-2-methylbenzenesulfinate.
| Compound Name | 5-tert-butyl-3-[[2-chloro-4-(trifluoromethylsulfonyl)phenyl]carbamoyl]-4-hydroxy-2-methylbenzenesulfinate |
|---|---|
| PubChem CID | 59191196 |
| Molecular Formula | C19H18ClF3NO6S2- |
| Molecular Weight | 512.94 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | 5-tert-butyl-3-[[2-chloro-4-(trifluoromethylsulfonyl)phenyl]carbamoyl]-4-hydroxy-2-methylbenzenesulfinate |
| SMILES | Cc1c(S(=O)[O-])cc(C(C)(C)C)c(O)c1C(=O)Nc1ccc(S(=O)(=O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C19H19ClF3NO6S2/c1-9-14(31(27)28)8-11(18(2,3)4)16(25)15(9)17(26)24-13-6-5-10(7-12(13)20)32(29,30)19(21,22)23/h5-8,25H,1-4H3,(H,24,26)(H,27,28)/p-1 |
| InChIKey | SHOCQALANRGLFL-UHFFFAOYSA-M |
| XLogP | 4.44 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|