C40H40ClNO3 — CID 174538499
3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2,6-dihydroxybenzamide (PubChem CID 174538499) has the molecular formula C40H40ClNO3 and a molecular weight of 618.22 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2,6-dihydroxybenzamide.
| Compound Name | 3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 174538499 |
| Molecular Formula | C40H40ClNO3 |
| Molecular Weight | 618.22 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 3,5-ditert-butyl-N-(2-chloro-4-tritylphenyl)-2,6-dihydroxybenzamide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O)c(C(=O)Nc2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2Cl)c1O |
| InChI | InChI=1S/C40H40ClNO3/c1-38(2,3)30-25-31(39(4,5)6)36(44)34(35(30)43)37(45)42-33-23-22-29(24-32(33)41)40(26-16-10-7-11-17-26,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-25,43-44H,1-6H3,(H,42,45) |
| InChIKey | FGYOFUDCJYCNCN-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.22 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|