C12H13Cl4NO — CID 2781894
N-(4-tert-butyl-2-chlorophenyl)-2,2,2-trichloroacetamide (PubChem CID 2781894) has the molecular formula C12H13Cl4NO and a molecular weight of 329.05 g/mol. Its IUPAC name is N-(4-tert-butyl-2-chlorophenyl)-2,2,2-trichloroacetamide.
| Compound Name | N-(4-tert-butyl-2-chlorophenyl)-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 2781894 |
| Molecular Formula | C12H13Cl4NO |
| Molecular Weight | 329.05 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | N-(4-tert-butyl-2-chlorophenyl)-2,2,2-trichloroacetamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C(Cl)(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl4NO/c1-11(2,3)7-4-5-9(8(13)6-7)17-10(18)12(14,15)16/h4-6H,1-3H3,(H,17,18) |
| InChIKey | LRCRPLNVUBDESN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|