C12H13ClN2O2 — CID 169354945
N-(2-chloro-4-isocyanatophenyl)-2,2-dimethylpropanamide (PubChem CID 169354945) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(2-chloro-4-isocyanatophenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(2-chloro-4-isocyanatophenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 169354945 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(2-chloro-4-isocyanatophenyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(N=C=O)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O2/c1-12(2,3)11(17)15-10-5-4-8(14-7-16)6-9(10)13/h4-6H,1-3H3,(H,15,17) |
| InChIKey | UCXVRVWNOIYNRK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|