C11H13ClNO4S- — CID 130199645
6-chloro-3-(2,2-dimethylpropanoylamino)-2-hydroxybenzenesulfinate (PubChem CID 130199645) has the molecular formula C11H13ClNO4S- and a molecular weight of 290.75 g/mol. Its IUPAC name is 6-chloro-3-(2,2-dimethylpropanoylamino)-2-hydroxybenzenesulfinate.
| Compound Name | 6-chloro-3-(2,2-dimethylpropanoylamino)-2-hydroxybenzenesulfinate |
|---|---|
| PubChem CID | 130199645 |
| Molecular Formula | C11H13ClNO4S- |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 6-chloro-3-(2,2-dimethylpropanoylamino)-2-hydroxybenzenesulfinate |
| SMILES | CC(C)(C)C(=O)Nc1ccc(Cl)c(S(=O)[O-])c1O |
| InChI | InChI=1S/C11H14ClNO4S/c1-11(2,3)10(15)13-7-5-4-6(12)9(8(7)14)18(16)17/h4-5,14H,1-3H3,(H,13,15)(H,16,17)/p-1 |
| InChIKey | LQJIPUSKIFBBAH-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|