C41H42ClNO3S — CID 174552844
3-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxy-6-methyl-5-(2-methylpropylsulfinyl)benzamide (PubChem CID 174552844) has the molecular formula C41H42ClNO3S and a molecular weight of 664.31 g/mol. Its IUPAC name is 3-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxy-6-methyl-5-(2-methylpropylsulfinyl)benzamide.
| Compound Name | 3-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxy-6-methyl-5-(2-methylpropylsulfinyl)benzamide |
|---|---|
| PubChem CID | 174552844 |
| Molecular Formula | C41H42ClNO3S |
| Molecular Weight | 664.31 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | 3-butyl-N-(2-chloro-4-tritylphenyl)-2-hydroxy-6-methyl-5-(2-methylpropylsulfinyl)benzamide |
| SMILES | CCCCc1cc(S(=O)CC(C)C)c(C)c(C(=O)Nc2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2Cl)c1O |
| InChI | InChI=1S/C41H42ClNO3S/c1-5-6-16-30-25-37(47(46)27-28(2)3)29(4)38(39(30)44)40(45)43-36-24-23-34(26-35(36)42)41(31-17-10-7-11-18-31,32-19-12-8-13-20-32)33-21-14-9-15-22-33/h7-15,17-26,28,44H,5-6,16,27H2,1-4H3,(H,43,45) |
| InChIKey | RVNFRZAEUBGDOM-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.31 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|