C39H39NO3S — CID 174552808
3-butyl-2-hydroxy-6-methyl-5-methylsulfinyl-N-(2-methyl-4-tritylphenyl)benzamide (PubChem CID 174552808) has the molecular formula C39H39NO3S and a molecular weight of 601.81 g/mol. Its IUPAC name is 3-butyl-2-hydroxy-6-methyl-5-methylsulfinyl-N-(2-methyl-4-tritylphenyl)benzamide.
| Compound Name | 3-butyl-2-hydroxy-6-methyl-5-methylsulfinyl-N-(2-methyl-4-tritylphenyl)benzamide |
|---|---|
| PubChem CID | 174552808 |
| Molecular Formula | C39H39NO3S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 3-butyl-2-hydroxy-6-methyl-5-methylsulfinyl-N-(2-methyl-4-tritylphenyl)benzamide |
| SMILES | CCCCc1cc(S(C)=O)c(C)c(C(=O)Nc2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2C)c1O |
| InChI | InChI=1S/C39H39NO3S/c1-5-6-16-29-26-35(44(4)43)28(3)36(37(29)41)38(42)40-34-24-23-33(25-27(34)2)39(30-17-10-7-11-18-30,31-19-12-8-13-20-31)32-21-14-9-15-22-32/h7-15,17-26,41H,5-6,16H2,1-4H3,(H,40,42) |
| InChIKey | DTANALUKWBSWLG-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|