C20H21NO4 — CID 174658957
5-[3-methyl-2-[(2-methylphenyl)carbamoyl]phenyl]-2-oxopentanoic acid (PubChem CID 174658957) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-[3-methyl-2-[(2-methylphenyl)carbamoyl]phenyl]-2-oxopentanoic acid.
| Compound Name | 5-[3-methyl-2-[(2-methylphenyl)carbamoyl]phenyl]-2-oxopentanoic acid |
|---|---|
| PubChem CID | 174658957 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 5-[3-methyl-2-[(2-methylphenyl)carbamoyl]phenyl]-2-oxopentanoic acid |
| SMILES | Cc1ccccc1NC(=O)c1c(C)cccc1CCCC(=O)C(=O)O |
| InChI | InChI=1S/C20H21NO4/c1-13-7-3-4-11-16(13)21-19(23)18-14(2)8-5-9-15(18)10-6-12-17(22)20(24)25/h3-5,7-9,11H,6,10,12H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | ZPRHSPPDPSYCIF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|