C18H19ClN2OS — CID 21314057
N-[(2-butyl-4-chlorophenyl)carbamothioyl]benzamide (PubChem CID 21314057) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is N-[(2-butyl-4-chlorophenyl)carbamothioyl]benzamide.
| Compound Name | N-[(2-butyl-4-chlorophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 21314057 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[(2-butyl-4-chlorophenyl)carbamothioyl]benzamide |
| SMILES | CCCCc1cc(Cl)ccc1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN2OS/c1-2-3-7-14-12-15(19)10-11-16(14)20-18(23)21-17(22)13-8-5-4-6-9-13/h4-6,8-12H,2-3,7H2,1H3,(H2,20,21,22,23) |
| InChIKey | RCVIOSBYVPGNIJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|